C13H11BrF2N2O3 — CID 107614393
4-[(4-bromo-2,5-difluorophenyl)carbamoylamino]cyclopent-2-ene-1-carboxylic acid (PubChem CID 107614393) has the molecular formula C13H11BrF2N2O3 and a molecular weight of 361.14 g/mol. Its IUPAC name is 4-[(4-bromo-2,5-difluorophenyl)carbamoylamino]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | 4-[(4-bromo-2,5-difluorophenyl)carbamoylamino]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 107614393 |
| Molecular Formula | C13H11BrF2N2O3 |
| Molecular Weight | 361.14 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 4-[(4-bromo-2,5-difluorophenyl)carbamoylamino]cyclopent-2-ene-1-carboxylic acid |
| SMILES | O=C(Nc1cc(F)c(Br)cc1F)NC1C=CC(C(=O)O)C1 |
| InChI | InChI=1S/C13H11BrF2N2O3/c14-8-4-10(16)11(5-9(8)15)18-13(21)17-7-2-1-6(3-7)12(19)20/h1-2,4-7H,3H2,(H,19,20)(H2,17,18,21) |
| InChIKey | YXODWAJFZBUHLT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.14 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|