C14H15BrF2N2O — CID 102853783
3-amino-N-(5-bromo-2,4-difluorophenyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 102853783) has the molecular formula C14H15BrF2N2O and a molecular weight of 345.19 g/mol. Its IUPAC name is 3-amino-N-(5-bromo-2,4-difluorophenyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | 3-amino-N-(5-bromo-2,4-difluorophenyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 102853783 |
| Molecular Formula | C14H15BrF2N2O |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 3-amino-N-(5-bromo-2,4-difluorophenyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC1C2CCC(C2)C1C(=O)Nc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C14H15BrF2N2O/c15-8-4-11(10(17)5-9(8)16)19-14(20)12-6-1-2-7(3-6)13(12)18/h4-7,12-13H,1-3,18H2,(H,19,20) |
| InChIKey | REPRPAHQNBNBKC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|