C14H15BrCl2N2O — CID 107790133
3-amino-N-(4-bromo-2,3-dichlorophenyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 107790133) has the molecular formula C14H15BrCl2N2O and a molecular weight of 378.10 g/mol. Its IUPAC name is 3-amino-N-(4-bromo-2,3-dichlorophenyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | 3-amino-N-(4-bromo-2,3-dichlorophenyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 107790133 |
| Molecular Formula | C14H15BrCl2N2O |
| Molecular Weight | 378.10 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 3-amino-N-(4-bromo-2,3-dichlorophenyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC1C2CCC(C2)C1C(=O)Nc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C14H15BrCl2N2O/c15-8-3-4-9(12(17)11(8)16)19-14(20)10-6-1-2-7(5-6)13(10)18/h3-4,6-7,10,13H,1-2,5,18H2,(H,19,20) |
| InChIKey | HTTXHUXXXDDLLQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.10 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|