C12H13BrCl2N2O2 — CID 107790383
N-(4-bromo-2,3-dichlorophenyl)-4-methoxypyrrolidine-2-carboxamide (PubChem CID 107790383) has the molecular formula C12H13BrCl2N2O2 and a molecular weight of 368.06 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-4-methoxypyrrolidine-2-carboxamide.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-4-methoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 107790383 |
| Molecular Formula | C12H13BrCl2N2O2 |
| Molecular Weight | 368.06 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-4-methoxypyrrolidine-2-carboxamide |
| SMILES | COC1CNC(C(=O)Nc2ccc(Br)c(Cl)c2Cl)C1 |
| InChI | InChI=1S/C12H13BrCl2N2O2/c1-19-6-4-9(16-5-6)12(18)17-8-3-2-7(13)10(14)11(8)15/h2-3,6,9,16H,4-5H2,1H3,(H,17,18) |
| InChIKey | JVVRNGBHKUNEPG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.06 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|