C12H14Br2N2O2 — CID 61214476
N-(2,4-dibromophenyl)-4-methoxypyrrolidine-2-carboxamide (PubChem CID 61214476) has the molecular formula C12H14Br2N2O2 and a molecular weight of 378.06 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-4-methoxypyrrolidine-2-carboxamide.
| Compound Name | N-(2,4-dibromophenyl)-4-methoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 61214476 |
| Molecular Formula | C12H14Br2N2O2 |
| Molecular Weight | 378.06 g/mol |
| Exact Mass | 375.94 |
| IUPAC Name | N-(2,4-dibromophenyl)-4-methoxypyrrolidine-2-carboxamide |
| SMILES | COC1CNC(C(=O)Nc2ccc(Br)cc2Br)C1 |
| InChI | InChI=1S/C12H14Br2N2O2/c1-18-8-5-11(15-6-8)12(17)16-10-3-2-7(13)4-9(10)14/h2-4,8,11,15H,5-6H2,1H3,(H,16,17) |
| InChIKey | SVGOGDMBAJONOS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.06 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |