C11H7BrCl2N2O4 — CID 107792647
5-[(4-bromo-2,3-dichlorophenyl)carbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid (PubChem CID 107792647) has the molecular formula C11H7BrCl2N2O4 and a molecular weight of 382.00 g/mol. Its IUPAC name is 5-[(4-bromo-2,3-dichlorophenyl)carbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[(4-bromo-2,3-dichlorophenyl)carbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107792647 |
| Molecular Formula | C11H7BrCl2N2O4 |
| Molecular Weight | 382.00 g/mol |
| Exact Mass | 379.90 |
| IUPAC Name | 5-[(4-bromo-2,3-dichlorophenyl)carbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)C1=NOC(C(=O)Nc2ccc(Br)c(Cl)c2Cl)C1 |
| InChI | InChI=1S/C11H7BrCl2N2O4/c12-4-1-2-5(9(14)8(4)13)15-10(17)7-3-6(11(18)19)16-20-7/h1-2,7H,3H2,(H,15,17)(H,18,19) |
| InChIKey | XXXGUCYOJBKIKA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.00 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|