C11H8ClN3O6 — CID 107812072
5-[(4-chloro-3-nitrophenyl)carbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid (PubChem CID 107812072) has the molecular formula C11H8ClN3O6 and a molecular weight of 313.65 g/mol. Its IUPAC name is 5-[(4-chloro-3-nitrophenyl)carbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[(4-chloro-3-nitrophenyl)carbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107812072 |
| Molecular Formula | C11H8ClN3O6 |
| Molecular Weight | 313.65 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 5-[(4-chloro-3-nitrophenyl)carbamoyl]-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)C1=NOC(C(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C11H8ClN3O6/c12-6-2-1-5(3-8(6)15(19)20)13-10(16)9-4-7(11(17)18)14-21-9/h1-3,9H,4H2,(H,13,16)(H,17,18) |
| InChIKey | JJGJZUHSZLZQCH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.65 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|