C16H19F3N2O2 — CID 111630159
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 111630159) has the molecular formula C16H19F3N2O2 and a molecular weight of 328.33 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 111630159 |
| Molecular Formula | C16H19F3N2O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | O=C(NCCc1ccc(C(F)(F)F)cc1)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C16H19F3N2O2/c17-16(18,19)13-4-1-11(2-5-13)7-8-20-15(23)21-14-6-3-12(9-14)10-22/h1-6,12,14,22H,7-10H2,(H2,20,21,23)/t12-,14+/m0/s1 |
| InChIKey | FGPWZBRKTAVZCU-GXTWGEPZSA-N |
| XLogP | 2.48 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|