C24H32BrN5O — CID 135514612
4-[(7-bromo-1,5-naphthyridin-4-yl)amino]-2,6-bis(diethylaminomethyl)phenol (PubChem CID 135514612) has the molecular formula C24H32BrN5O and a molecular weight of 486.46 g/mol. Its IUPAC name is 4-[(7-bromo-1,5-naphthyridin-4-yl)amino]-2,6-bis(diethylaminomethyl)phenol.
| Compound Name | 4-[(7-bromo-1,5-naphthyridin-4-yl)amino]-2,6-bis(diethylaminomethyl)phenol |
|---|---|
| PubChem CID | 135514612 |
| Molecular Formula | C24H32BrN5O |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 4-[(7-bromo-1,5-naphthyridin-4-yl)amino]-2,6-bis(diethylaminomethyl)phenol |
| SMILES | CCN(CC)Cc1cc(Nc2ccnc3cc(Br)cnc23)cc(CN(CC)CC)c1O |
| InChI | InChI=1S/C24H32BrN5O/c1-5-29(6-2)15-17-11-20(12-18(24(17)31)16-30(7-3)8-4)28-21-9-10-26-22-13-19(25)14-27-23(21)22/h9-14,31H,5-8,15-16H2,1-4H3,(H,26,28) |
| InChIKey | DOOGNRKMBHZHFS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|