C21H23BrN4O — CID 135546135
2-[(7-bromo-1,5-naphthyridin-4-yl)amino]-6-[(3-methylpiperidin-1-yl)methyl]phenol (PubChem CID 135546135) has the molecular formula C21H23BrN4O and a molecular weight of 427.35 g/mol. Its IUPAC name is 2-[(7-bromo-1,5-naphthyridin-4-yl)amino]-6-[(3-methylpiperidin-1-yl)methyl]phenol.
| Compound Name | 2-[(7-bromo-1,5-naphthyridin-4-yl)amino]-6-[(3-methylpiperidin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 135546135 |
| Molecular Formula | C21H23BrN4O |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 2-[(7-bromo-1,5-naphthyridin-4-yl)amino]-6-[(3-methylpiperidin-1-yl)methyl]phenol |
| SMILES | CC1CCCN(Cc2cccc(Nc3ccnc4cc(Br)cnc34)c2O)C1 |
| InChI | InChI=1S/C21H23BrN4O/c1-14-4-3-9-26(12-14)13-15-5-2-6-18(21(15)27)25-17-7-8-23-19-10-16(22)11-24-20(17)19/h2,5-8,10-11,14,27H,3-4,9,12-13H2,1H3,(H,23,25) |
| InChIKey | NEZSCGKTPHAYCO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|