C23H24ClF3N4O — CID 135485617
4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-[[7-(trifluoromethyl)-1,5-naphthyridin-4-yl]amino]phenol (PubChem CID 135485617) has the molecular formula C23H24ClF3N4O and a molecular weight of 464.92 g/mol. Its IUPAC name is 4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-[[7-(trifluoromethyl)-1,5-naphthyridin-4-yl]amino]phenol.
| Compound Name | 4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-[[7-(trifluoromethyl)-1,5-naphthyridin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 135485617 |
| Molecular Formula | C23H24ClF3N4O |
| Molecular Weight | 464.92 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 4-chloro-2-[(3,5-dimethylpiperidin-1-yl)methyl]-6-[[7-(trifluoromethyl)-1,5-naphthyridin-4-yl]amino]phenol |
| SMILES | CC1CC(C)CN(Cc2cc(Cl)cc(Nc3ccnc4cc(C(F)(F)F)cnc34)c2O)C1 |
| InChI | InChI=1S/C23H24ClF3N4O/c1-13-5-14(2)11-31(10-13)12-15-6-17(24)8-20(22(15)32)30-18-3-4-28-19-7-16(23(25,26)27)9-29-21(18)19/h3-4,6-9,13-14,32H,5,10-12H2,1-2H3,(H,28,30) |
| InChIKey | MRNUEXBTTPXYCK-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.92 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|