C24H27N5O — CID 135507191
2-(diethylaminomethyl)-4-[(2,3-dimethylpyrido[3,2-f]quinoxalin-10-yl)amino]phenol (PubChem CID 135507191) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is 2-(diethylaminomethyl)-4-[(2,3-dimethylpyrido[3,2-f]quinoxalin-10-yl)amino]phenol.
| Compound Name | 2-(diethylaminomethyl)-4-[(2,3-dimethylpyrido[3,2-f]quinoxalin-10-yl)amino]phenol |
|---|---|
| PubChem CID | 135507191 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 2-(diethylaminomethyl)-4-[(2,3-dimethylpyrido[3,2-f]quinoxalin-10-yl)amino]phenol |
| SMILES | CCN(CC)Cc1cc(Nc2ccnc3ccc4nc(C)c(C)nc4c23)ccc1O |
| InChI | InChI=1S/C24H27N5O/c1-5-29(6-2)14-17-13-18(7-10-22(17)30)28-20-11-12-25-19-8-9-21-24(23(19)20)27-16(4)15(3)26-21/h7-13,30H,5-6,14H2,1-4H3,(H,25,28) |
| InChIKey | DKKTUVDCEJKCSX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|