C31H30F3N5O — CID 135546264
2-(diethylaminomethyl)-4-[[2,3-dimethyl-8-[3-(trifluoromethyl)phenyl]pyrido[3,2-f]quinoxalin-10-yl]amino]phenol (PubChem CID 135546264) has the molecular formula C31H30F3N5O and a molecular weight of 545.61 g/mol. Its IUPAC name is 2-(diethylaminomethyl)-4-[[2,3-dimethyl-8-[3-(trifluoromethyl)phenyl]pyrido[3,2-f]quinoxalin-10-yl]amino]phenol.
| Compound Name | 2-(diethylaminomethyl)-4-[[2,3-dimethyl-8-[3-(trifluoromethyl)phenyl]pyrido[3,2-f]quinoxalin-10-yl]amino]phenol |
|---|---|
| PubChem CID | 135546264 |
| Molecular Formula | C31H30F3N5O |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | 2-(diethylaminomethyl)-4-[[2,3-dimethyl-8-[3-(trifluoromethyl)phenyl]pyrido[3,2-f]quinoxalin-10-yl]amino]phenol |
| SMILES | CCN(CC)Cc1cc(Nc2cc(-c3cccc(C(F)(F)F)c3)nc3ccc4nc(C)c(C)nc4c23)ccc1O |
| InChI | InChI=1S/C31H30F3N5O/c1-5-39(6-2)17-21-15-23(10-13-28(21)40)37-27-16-26(20-8-7-9-22(14-20)31(32,33)34)38-24-11-12-25-30(29(24)27)36-19(4)18(3)35-25/h7-16,40H,5-6,17H2,1-4H3,(H,37,38) |
| InChIKey | FSVIZVVVTFNXAA-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|