C19H27ClN4 — CID 118735280
N-(7-chloroquinolin-4-yl)-N'-[2-(diethylamino)ethyl]-2-methylpropanimidamide (PubChem CID 118735280) has the molecular formula C19H27ClN4 and a molecular weight of 346.91 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N'-[2-(diethylamino)ethyl]-2-methylpropanimidamide.
| Compound Name | N-(7-chloroquinolin-4-yl)-N'-[2-(diethylamino)ethyl]-2-methylpropanimidamide |
|---|---|
| PubChem CID | 118735280 |
| Molecular Formula | C19H27ClN4 |
| Molecular Weight | 346.91 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N'-[2-(diethylamino)ethyl]-2-methylpropanimidamide |
| SMILES | CCN(CC)CC/N=C(/Nc1ccnc2cc(Cl)ccc12)C(C)C |
| InChI | InChI=1S/C19H27ClN4/c1-5-24(6-2)12-11-22-19(14(3)4)23-17-9-10-21-18-13-15(20)7-8-16(17)18/h7-10,13-14H,5-6,11-12H2,1-4H3,(H,21,22,23) |
| InChIKey | OHQOMVXTBSZIFH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.91 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|