C26H32N4O — CID 13362496
4-[(2-methylquinolin-4-yl)amino]-2,6-bis(pyrrolidin-1-ylmethyl)phenol (PubChem CID 13362496) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is 4-[(2-methylquinolin-4-yl)amino]-2,6-bis(pyrrolidin-1-ylmethyl)phenol.
| Compound Name | 4-[(2-methylquinolin-4-yl)amino]-2,6-bis(pyrrolidin-1-ylmethyl)phenol |
|---|---|
| PubChem CID | 13362496 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 4-[(2-methylquinolin-4-yl)amino]-2,6-bis(pyrrolidin-1-ylmethyl)phenol |
| SMILES | Cc1cc(Nc2cc(CN3CCCC3)c(O)c(CN3CCCC3)c2)c2ccccc2n1 |
| InChI | InChI=1S/C26H32N4O/c1-19-14-25(23-8-2-3-9-24(23)27-19)28-22-15-20(17-29-10-4-5-11-29)26(31)21(16-22)18-30-12-6-7-13-30/h2-3,8-9,14-16,31H,4-7,10-13,17-18H2,1H3,(H,27,28) |
| InChIKey | SKNAOUOYPRJMQV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|