C19H27N3 — CID 71899453
2-methyl-N-(2-methyl-2-piperidin-1-ylpropyl)quinolin-4-amine (PubChem CID 71899453) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is 2-methyl-N-(2-methyl-2-piperidin-1-ylpropyl)quinolin-4-amine.
| Compound Name | 2-methyl-N-(2-methyl-2-piperidin-1-ylpropyl)quinolin-4-amine |
|---|---|
| PubChem CID | 71899453 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 2-methyl-N-(2-methyl-2-piperidin-1-ylpropyl)quinolin-4-amine |
| SMILES | Cc1cc(NCC(C)(C)N2CCCCC2)c2ccccc2n1 |
| InChI | InChI=1S/C19H27N3/c1-15-13-18(16-9-5-6-10-17(16)21-15)20-14-19(2,3)22-11-7-4-8-12-22/h5-6,9-10,13H,4,7-8,11-12,14H2,1-3H3,(H,20,21) |
| InChIKey | HFNLPBAVYHJPBL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |