C22H17ClN4O3S — CID 71530749
1-[4-[(7-chloroquinolin-4-yl)amino]phenyl]sulfonyl-3-phenylurea (PubChem CID 71530749) has the molecular formula C22H17ClN4O3S and a molecular weight of 452.92 g/mol. Its IUPAC name is 1-[4-[(7-chloroquinolin-4-yl)amino]phenyl]sulfonyl-3-phenylurea.
| Compound Name | 1-[4-[(7-chloroquinolin-4-yl)amino]phenyl]sulfonyl-3-phenylurea |
|---|---|
| PubChem CID | 71530749 |
| Molecular Formula | C22H17ClN4O3S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 1-[4-[(7-chloroquinolin-4-yl)amino]phenyl]sulfonyl-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)NS(=O)(=O)c1ccc(Nc2ccnc3cc(Cl)ccc23)cc1 |
| InChI | InChI=1S/C22H17ClN4O3S/c23-15-6-11-19-20(12-13-24-21(19)14-15)25-17-7-9-18(10-8-17)31(29,30)27-22(28)26-16-4-2-1-3-5-16/h1-14H,(H,24,25)(H2,26,27,28) |
| InChIKey | JCJZQILAOZSKRJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |