C23H17F3N4O3S — CID 73349407
1-phenyl-3-[4-[[7-(trifluoromethyl)quinolin-4-yl]sulfamoyl]phenyl]urea (PubChem CID 73349407) has the molecular formula C23H17F3N4O3S and a molecular weight of 486.48 g/mol. Its IUPAC name is 1-phenyl-3-[4-[[7-(trifluoromethyl)quinolin-4-yl]sulfamoyl]phenyl]urea.
| Compound Name | 1-phenyl-3-[4-[[7-(trifluoromethyl)quinolin-4-yl]sulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 73349407 |
| Molecular Formula | C23H17F3N4O3S |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 1-phenyl-3-[4-[[7-(trifluoromethyl)quinolin-4-yl]sulfamoyl]phenyl]urea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(S(=O)(=O)Nc2ccnc3cc(C(F)(F)F)ccc23)cc1 |
| InChI | InChI=1S/C23H17F3N4O3S/c24-23(25,26)15-6-11-19-20(12-13-27-21(19)14-15)30-34(32,33)18-9-7-17(8-10-18)29-22(31)28-16-4-2-1-3-5-16/h1-14H,(H,27,30)(H2,28,29,31) |
| InChIKey | JPCKFXOCVWDHDS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |