C25H27ClN4 — CID 16719030
7-chloro-N-[3-(diethylaminomethyl)-5-methyl-2-phenylpyrrol-1-yl]quinolin-4-amine (PubChem CID 16719030) has the molecular formula C25H27ClN4 and a molecular weight of 418.97 g/mol. Its IUPAC name is 7-chloro-N-[3-(diethylaminomethyl)-5-methyl-2-phenylpyrrol-1-yl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[3-(diethylaminomethyl)-5-methyl-2-phenylpyrrol-1-yl]quinolin-4-amine |
|---|---|
| PubChem CID | 16719030 |
| Molecular Formula | C25H27ClN4 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 7-chloro-N-[3-(diethylaminomethyl)-5-methyl-2-phenylpyrrol-1-yl]quinolin-4-amine |
| SMILES | CCN(CC)Cc1cc(C)n(Nc2ccnc3cc(Cl)ccc23)c1-c1ccccc1 |
| InChI | InChI=1S/C25H27ClN4/c1-4-29(5-2)17-20-15-18(3)30(25(20)19-9-7-6-8-10-19)28-23-13-14-27-24-16-21(26)11-12-22(23)24/h6-16H,4-5,17H2,1-3H3,(H,27,28) |
| InChIKey | IUSSIVJPHOHBQW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |