C25H25ClN4 — CID 174570186
7-chloro-N-[3-(2-iminopentyl)-2-methyl-5-phenylpyrrol-1-yl]quinolin-4-amine (PubChem CID 174570186) has the molecular formula C25H25ClN4 and a molecular weight of 416.96 g/mol. Its IUPAC name is 7-chloro-N-[3-(2-iminopentyl)-2-methyl-5-phenylpyrrol-1-yl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[3-(2-iminopentyl)-2-methyl-5-phenylpyrrol-1-yl]quinolin-4-amine |
|---|---|
| PubChem CID | 174570186 |
| Molecular Formula | C25H25ClN4 |
| Molecular Weight | 416.96 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 7-chloro-N-[3-(2-iminopentyl)-2-methyl-5-phenylpyrrol-1-yl]quinolin-4-amine |
| SMILES | [H]/N=C(\CCC)Cc1cc(-c2ccccc2)n(Nc2ccnc3cc(Cl)ccc23)c1C |
| InChI | InChI=1S/C25H25ClN4/c1-3-7-21(27)14-19-15-25(18-8-5-4-6-9-18)30(17(19)2)29-23-12-13-28-24-16-20(26)10-11-22(23)24/h4-6,8-13,15-16,27H,3,7,14H2,1-2H3,(H,28,29)/b27-21+ |
| InChIKey | QMQVVYRNLWYYCP-SZXQPVLSSA-N |
| XLogP | 6.90 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.96 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|