C25H29ClN4O5S — CID 125050297
(3S)-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 125050297) has the molecular formula C25H29ClN4O5S and a molecular weight of 533.05 g/mol. Its IUPAC name is (3S)-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 125050297 |
| Molecular Formula | C25H29ClN4O5S |
| Molecular Weight | 533.05 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | (3S)-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)NCCNc3ccnc4cc(Cl)ccc34)C2)cc1OC |
| InChI | InChI=1S/C25H29ClN4O5S/c1-34-23-8-6-19(15-24(23)35-2)36(32,33)30-13-3-4-17(16-30)25(31)29-12-11-28-21-9-10-27-22-14-18(26)5-7-20(21)22/h5-10,14-15,17H,3-4,11-13,16H2,1-2H3,(H,27,28)(H,29,31)/t17-/m0/s1 |
| InChIKey | UDTASZPLEKLUNT-KRWDZBQOSA-N |
| XLogP | 3.53 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.05 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|