C25H28Cl2N4O4S — CID 100800020
1-(3-chloro-4-methoxyphenyl)sulfonyl-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]piperidine-4-carboxamide (PubChem CID 100800020) has the molecular formula C25H28Cl2N4O4S and a molecular weight of 551.50 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)sulfonyl-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]piperidine-4-carboxamide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)sulfonyl-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 100800020 |
| Molecular Formula | C25H28Cl2N4O4S |
| Molecular Weight | 551.50 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)sulfonyl-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(C(=O)NCCCNc3ccnc4cc(Cl)ccc34)CC2)cc1Cl |
| InChI | InChI=1S/C25H28Cl2N4O4S/c1-35-24-6-4-19(16-21(24)27)36(33,34)31-13-8-17(9-14-31)25(32)30-11-2-10-28-22-7-12-29-23-15-18(26)3-5-20(22)23/h3-7,12,15-17H,2,8-11,13-14H2,1H3,(H,28,29)(H,30,32) |
| InChIKey | YXVMZAVLVTVOQB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|