C26H30Cl2N4O4S — CID 133163531
1-(3-chloro-4-ethoxyphenyl)sulfonyl-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]piperidine-3-carboxamide (PubChem CID 133163531) has the molecular formula C26H30Cl2N4O4S and a molecular weight of 565.52 g/mol. Its IUPAC name is 1-(3-chloro-4-ethoxyphenyl)sulfonyl-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-(3-chloro-4-ethoxyphenyl)sulfonyl-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133163531 |
| Molecular Formula | C26H30Cl2N4O4S |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | 1-(3-chloro-4-ethoxyphenyl)sulfonyl-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]piperidine-3-carboxamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCCC(C(=O)NCCCNc3ccnc4cc(Cl)ccc34)C2)cc1Cl |
| InChI | InChI=1S/C26H30Cl2N4O4S/c1-2-36-25-9-7-20(16-22(25)28)37(34,35)32-14-3-5-18(17-32)26(33)31-12-4-11-29-23-10-13-30-24-15-19(27)6-8-21(23)24/h6-10,13,15-16,18H,2-5,11-12,14,17H2,1H3,(H,29,30)(H,31,33) |
| InChIKey | HEBALJNABSUTJE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|