C23H24Cl2N4O3S — CID 100798913
1-(4-chlorophenyl)sulfonyl-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]piperidine-4-carboxamide (PubChem CID 100798913) has the molecular formula C23H24Cl2N4O3S and a molecular weight of 507.44 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 100798913 |
| Molecular Formula | C23H24Cl2N4O3S |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCNc1ccnc2cc(Cl)ccc12)C1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H24Cl2N4O3S/c24-17-1-4-19(5-2-17)33(31,32)29-13-8-16(9-14-29)23(30)28-12-11-27-21-7-10-26-22-15-18(25)3-6-20(21)22/h1-7,10,15-16H,8-9,11-14H2,(H,26,27)(H,28,30) |
| InChIKey | GRWQVVNVSPOVRW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|