C15H16ClN3OS2 — CID 100562947
1-[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]-3-(3-hydroxypropyl)thiourea (PubChem CID 100562947) has the molecular formula C15H16ClN3OS2 and a molecular weight of 353.90 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]-3-(3-hydroxypropyl)thiourea.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]-3-(3-hydroxypropyl)thiourea |
|---|---|
| PubChem CID | 100562947 |
| Molecular Formula | C15H16ClN3OS2 |
| Molecular Weight | 353.90 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]-3-(3-hydroxypropyl)thiourea |
| SMILES | OCCCNC(=S)Nc1cccnc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16ClN3OS2/c16-11-4-6-12(7-5-11)22-14-13(3-1-8-17-14)19-15(21)18-9-2-10-20/h1,3-8,20H,2,9-10H2,(H2,18,19,21) |
| InChIKey | QXXHJIAHYHKAPE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.90 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|