C15H15BrN2O2S — CID 78854403
2-(4-bromophenyl)sulfanyl-N-(3-hydroxypropyl)pyridine-3-carboxamide (PubChem CID 78854403) has the molecular formula C15H15BrN2O2S and a molecular weight of 367.27 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-N-(3-hydroxypropyl)pyridine-3-carboxamide.
| Compound Name | 2-(4-bromophenyl)sulfanyl-N-(3-hydroxypropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 78854403 |
| Molecular Formula | C15H15BrN2O2S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-N-(3-hydroxypropyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCCO)c1cccnc1Sc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H15BrN2O2S/c16-11-4-6-12(7-5-11)21-15-13(3-1-8-18-15)14(20)17-9-2-10-19/h1,3-8,19H,2,9-10H2,(H,17,20) |
| InChIKey | USMKROPTAJBJJG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|