C17H17BrN2O3S — CID 56550977
propan-2-yl 2-[[2-(4-bromophenyl)sulfanylpyridine-3-carbonyl]amino]acetate (PubChem CID 56550977) has the molecular formula C17H17BrN2O3S and a molecular weight of 409.31 g/mol. Its IUPAC name is propan-2-yl 2-[[2-(4-bromophenyl)sulfanylpyridine-3-carbonyl]amino]acetate.
| Compound Name | propan-2-yl 2-[[2-(4-bromophenyl)sulfanylpyridine-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 56550977 |
| Molecular Formula | C17H17BrN2O3S |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | propan-2-yl 2-[[2-(4-bromophenyl)sulfanylpyridine-3-carbonyl]amino]acetate |
| SMILES | CC(C)OC(=O)CNC(=O)c1cccnc1Sc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H17BrN2O3S/c1-11(2)23-15(21)10-20-16(22)14-4-3-9-19-17(14)24-13-7-5-12(18)6-8-13/h3-9,11H,10H2,1-2H3,(H,20,22) |
| InChIKey | JEXTYTMTIACMEB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |