C9H11BrN2O2 — CID 103819583
2-bromo-N-(3-hydroxypropyl)pyridine-3-carboxamide (PubChem CID 103819583) has the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. Its IUPAC name is 2-bromo-N-(3-hydroxypropyl)pyridine-3-carboxamide.
| Compound Name | 2-bromo-N-(3-hydroxypropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103819583 |
| Molecular Formula | C9H11BrN2O2 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 2-bromo-N-(3-hydroxypropyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCCO)c1cccnc1Br |
| InChI | InChI=1S/C9H11BrN2O2/c10-8-7(3-1-4-11-8)9(14)12-5-2-6-13/h1,3-4,13H,2,5-6H2,(H,12,14) |
| InChIKey | SRKLJIRCGKILAS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|