C12H17BrN2O2 — CID 103755024
2-bromo-N-(5-methoxypentyl)pyridine-3-carboxamide (PubChem CID 103755024) has the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. Its IUPAC name is 2-bromo-N-(5-methoxypentyl)pyridine-3-carboxamide.
| Compound Name | 2-bromo-N-(5-methoxypentyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103755024 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-bromo-N-(5-methoxypentyl)pyridine-3-carboxamide |
| SMILES | COCCCCCNC(=O)c1cccnc1Br |
| InChI | InChI=1S/C12H17BrN2O2/c1-17-9-4-2-3-7-15-12(16)10-6-5-8-14-11(10)13/h5-6,8H,2-4,7,9H2,1H3,(H,15,16) |
| InChIKey | UOLFJHCNDWAGSK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|