C20H24BrN3OS — CID 55514779
2-(4-bromophenyl)sulfanyl-N-(1-propylpiperidin-4-yl)pyridine-3-carboxamide (PubChem CID 55514779) has the molecular formula C20H24BrN3OS and a molecular weight of 434.40 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-N-(1-propylpiperidin-4-yl)pyridine-3-carboxamide.
| Compound Name | 2-(4-bromophenyl)sulfanyl-N-(1-propylpiperidin-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55514779 |
| Molecular Formula | C20H24BrN3OS |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-N-(1-propylpiperidin-4-yl)pyridine-3-carboxamide |
| SMILES | CCCN1CCC(NC(=O)c2cccnc2Sc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C20H24BrN3OS/c1-2-12-24-13-9-16(10-14-24)23-19(25)18-4-3-11-22-20(18)26-17-7-5-15(21)6-8-17/h3-8,11,16H,2,9-10,12-14H2,1H3,(H,23,25) |
| InChIKey | LCMWSOARYOKVEO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |