C23H23N3OS — CID 9118983
N-[(3S)-1-benzylpyrrolidin-3-yl]-2-phenylsulfanylpyridine-3-carboxamide (PubChem CID 9118983) has the molecular formula C23H23N3OS and a molecular weight of 389.52 g/mol. Its IUPAC name is N-[(3S)-1-benzylpyrrolidin-3-yl]-2-phenylsulfanylpyridine-3-carboxamide.
| Compound Name | N-[(3S)-1-benzylpyrrolidin-3-yl]-2-phenylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 9118983 |
| Molecular Formula | C23H23N3OS |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | N-[(3S)-1-benzylpyrrolidin-3-yl]-2-phenylsulfanylpyridine-3-carboxamide |
| SMILES | O=C(N[C@H]1CCN(Cc2ccccc2)C1)c1cccnc1Sc1ccccc1 |
| InChI | InChI=1S/C23H23N3OS/c27-22(21-12-7-14-24-23(21)28-20-10-5-2-6-11-20)25-19-13-15-26(17-19)16-18-8-3-1-4-9-18/h1-12,14,19H,13,15-17H2,(H,25,27)/t19-/m0/s1 |
| InChIKey | YCVSONCWWOBJLX-IBGZPJMESA-N |
| XLogP | 4.24 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |