C23H24N3OS+ — CID 9118982
N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-2-phenylsulfanylpyridine-3-carboxamide (PubChem CID 9118982) has the molecular formula C23H24N3OS+ and a molecular weight of 390.53 g/mol. Its IUPAC name is N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-2-phenylsulfanylpyridine-3-carboxamide.
| Compound Name | N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-2-phenylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 9118982 |
| Molecular Formula | C23H24N3OS+ |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-2-phenylsulfanylpyridine-3-carboxamide |
| SMILES | O=C(N[C@H]1CC[NH+](Cc2ccccc2)C1)c1cccnc1Sc1ccccc1 |
| InChI | InChI=1S/C23H23N3OS/c27-22(21-12-7-14-24-23(21)28-20-10-5-2-6-11-20)25-19-13-15-26(17-19)16-18-8-3-1-4-9-18/h1-12,14,19H,13,15-17H2,(H,25,27)/p+1/t19-/m0/s1 |
| InChIKey | YCVSONCWWOBJLX-IBGZPJMESA-O |
| XLogP | 2.82 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |