C17H19ClN3O+ — CID 9488578
N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-4-chloropyridine-2-carboxamide (PubChem CID 9488578) has the molecular formula C17H19ClN3O+ and a molecular weight of 316.81 g/mol. Its IUPAC name is N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-4-chloropyridine-2-carboxamide.
| Compound Name | N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-4-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 9488578 |
| Molecular Formula | C17H19ClN3O+ |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]-4-chloropyridine-2-carboxamide |
| SMILES | O=C(N[C@H]1CC[NH+](Cc2ccccc2)C1)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C17H18ClN3O/c18-14-6-8-19-16(10-14)17(22)20-15-7-9-21(12-15)11-13-4-2-1-3-5-13/h1-6,8,10,15H,7,9,11-12H2,(H,20,22)/p+1/t15-/m0/s1 |
| InChIKey | YBSCEKQXNMNKDO-HNNXBMFYSA-O |
| XLogP | 1.32 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |