C21H22N3OS+ — CID 9488636
N-[(3R)-1-benzylpyrrolidin-1-ium-3-yl]-2-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 9488636) has the molecular formula C21H22N3OS+ and a molecular weight of 364.49 g/mol. Its IUPAC name is N-[(3R)-1-benzylpyrrolidin-1-ium-3-yl]-2-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(3R)-1-benzylpyrrolidin-1-ium-3-yl]-2-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 9488636 |
| Molecular Formula | C21H22N3OS+ |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-[(3R)-1-benzylpyrrolidin-1-ium-3-yl]-2-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(N[C@@H]1CC[NH+](Cc2ccccc2)C1)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H21N3OS/c25-20(19-15-26-21(23-19)17-9-5-2-6-10-17)22-18-11-12-24(14-18)13-16-7-3-1-4-8-16/h1-10,15,18H,11-14H2,(H,22,25)/p+1/t18-/m1/s1 |
| InChIKey | TZMYEDMGOPRYDP-GOSISDBHSA-O |
| XLogP | 2.40 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |