C18H20N4O2S — CID 46966805
N-[2-[(2,6-dimethylquinolin-4-yl)amino]ethyl]pyridine-3-sulfonamide (PubChem CID 46966805) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is N-[2-[(2,6-dimethylquinolin-4-yl)amino]ethyl]pyridine-3-sulfonamide.
| Compound Name | N-[2-[(2,6-dimethylquinolin-4-yl)amino]ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 46966805 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[2-[(2,6-dimethylquinolin-4-yl)amino]ethyl]pyridine-3-sulfonamide |
| SMILES | Cc1ccc2nc(C)cc(NCCNS(=O)(=O)c3cccnc3)c2c1 |
| InChI | InChI=1S/C18H20N4O2S/c1-13-5-6-17-16(10-13)18(11-14(2)22-17)20-8-9-21-25(23,24)15-4-3-7-19-12-15/h3-7,10-12,21H,8-9H2,1-2H3,(H,20,22) |
| InChIKey | AYBFHSFOGVUVDD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|