C15H16N4O2S2 — CID 133203213
3-(4-methylsulfanylphenyl)-3-(pyrimidin-2-ylcarbamothioylamino)propanoic acid (PubChem CID 133203213) has the molecular formula C15H16N4O2S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 3-(4-methylsulfanylphenyl)-3-(pyrimidin-2-ylcarbamothioylamino)propanoic acid.
| Compound Name | 3-(4-methylsulfanylphenyl)-3-(pyrimidin-2-ylcarbamothioylamino)propanoic acid |
|---|---|
| PubChem CID | 133203213 |
| Molecular Formula | C15H16N4O2S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 3-(4-methylsulfanylphenyl)-3-(pyrimidin-2-ylcarbamothioylamino)propanoic acid |
| SMILES | CSc1ccc(C(CC(=O)O)NC(=S)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C15H16N4O2S2/c1-23-11-5-3-10(4-6-11)12(9-13(20)21)18-15(22)19-14-16-7-2-8-17-14/h2-8,12H,9H2,1H3,(H,20,21)(H2,16,17,18,19,22) |
| InChIKey | YMWOWNYGPYDKFH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|