C14H12Cl2N4O2S — CID 100569059
(3R)-3-(2,4-dichlorophenyl)-3-(pyrimidin-2-ylcarbamothioylamino)propanoic acid (PubChem CID 100569059) has the molecular formula C14H12Cl2N4O2S and a molecular weight of 371.25 g/mol. Its IUPAC name is (3R)-3-(2,4-dichlorophenyl)-3-(pyrimidin-2-ylcarbamothioylamino)propanoic acid.
| Compound Name | (3R)-3-(2,4-dichlorophenyl)-3-(pyrimidin-2-ylcarbamothioylamino)propanoic acid |
|---|---|
| PubChem CID | 100569059 |
| Molecular Formula | C14H12Cl2N4O2S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | (3R)-3-(2,4-dichlorophenyl)-3-(pyrimidin-2-ylcarbamothioylamino)propanoic acid |
| SMILES | O=C(O)C[C@@H](NC(=S)Nc1ncccn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl2N4O2S/c15-8-2-3-9(10(16)6-8)11(7-12(21)22)19-14(23)20-13-17-4-1-5-18-13/h1-6,11H,7H2,(H,21,22)(H2,17,18,19,20,23)/t11-/m1/s1 |
| InChIKey | HYISEPNWTODVGN-LLVKDONJSA-N |
| XLogP | 3.29 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|