C16H15Cl2N3O2S — CID 100571623
(3R)-3-(2,4-dichlorophenyl)-3-[(4-methyl-2-pyridinyl)carbamothioylamino]propanoic acid (PubChem CID 100571623) has the molecular formula C16H15Cl2N3O2S and a molecular weight of 384.29 g/mol. Its IUPAC name is (3R)-3-(2,4-dichlorophenyl)-3-[(4-methyl-2-pyridinyl)carbamothioylamino]propanoic acid.
| Compound Name | (3R)-3-(2,4-dichlorophenyl)-3-[(4-methyl-2-pyridinyl)carbamothioylamino]propanoic acid |
|---|---|
| PubChem CID | 100571623 |
| Molecular Formula | C16H15Cl2N3O2S |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | (3R)-3-(2,4-dichlorophenyl)-3-[(4-methyl-2-pyridinyl)carbamothioylamino]propanoic acid |
| SMILES | Cc1ccnc(NC(=S)N[C@H](CC(=O)O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H15Cl2N3O2S/c1-9-4-5-19-14(6-9)21-16(24)20-13(8-15(22)23)11-3-2-10(17)7-12(11)18/h2-7,13H,8H2,1H3,(H,22,23)(H2,19,20,21,24)/t13-/m1/s1 |
| InChIKey | SNFXVWHRZMKIOX-CYBMUJFWSA-N |
| XLogP | 4.20 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|