C21H20N2O4S3 — CID 133203569
3-[(2-methoxycarbonyl-1-benzothiophen-5-yl)carbamothioylamino]-3-(4-methylsulfanylphenyl)propanoic acid (PubChem CID 133203569) has the molecular formula C21H20N2O4S3 and a molecular weight of 460.60 g/mol. Its IUPAC name is 3-[(2-methoxycarbonyl-1-benzothiophen-5-yl)carbamothioylamino]-3-(4-methylsulfanylphenyl)propanoic acid.
| Compound Name | 3-[(2-methoxycarbonyl-1-benzothiophen-5-yl)carbamothioylamino]-3-(4-methylsulfanylphenyl)propanoic acid |
|---|---|
| PubChem CID | 133203569 |
| Molecular Formula | C21H20N2O4S3 |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 3-[(2-methoxycarbonyl-1-benzothiophen-5-yl)carbamothioylamino]-3-(4-methylsulfanylphenyl)propanoic acid |
| SMILES | COC(=O)c1cc2cc(NC(=S)NC(CC(=O)O)c3ccc(SC)cc3)ccc2s1 |
| InChI | InChI=1S/C21H20N2O4S3/c1-27-20(26)18-10-13-9-14(5-8-17(13)30-18)22-21(28)23-16(11-19(24)25)12-3-6-15(29-2)7-4-12/h3-10,16H,11H2,1-2H3,(H,24,25)(H2,22,23,28) |
| InChIKey | OMAADAXDVSJCMM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|