C13H20N4O2S — CID 133203168
ethyl 2-(butan-2-ylcarbamothioylamino)-4-methylpyrimidine-5-carboxylate (PubChem CID 133203168) has the molecular formula C13H20N4O2S and a molecular weight of 296.40 g/mol. Its IUPAC name is ethyl 2-(butan-2-ylcarbamothioylamino)-4-methylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(butan-2-ylcarbamothioylamino)-4-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 133203168 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | ethyl 2-(butan-2-ylcarbamothioylamino)-4-methylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC(=S)NC(C)CC)nc1C |
| InChI | InChI=1S/C13H20N4O2S/c1-5-8(3)15-13(20)17-12-14-7-10(9(4)16-12)11(18)19-6-2/h7-8H,5-6H2,1-4H3,(H2,14,15,16,17,20) |
| InChIKey | JMPKUSPZPYMIGE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|