C17H19ClN4O2S — CID 100564809
ethyl 2-[[(1S)-1-(4-chlorophenyl)ethyl]carbamothioylamino]-4-methylpyrimidine-5-carboxylate (PubChem CID 100564809) has the molecular formula C17H19ClN4O2S and a molecular weight of 378.89 g/mol. Its IUPAC name is ethyl 2-[[(1S)-1-(4-chlorophenyl)ethyl]carbamothioylamino]-4-methylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[[(1S)-1-(4-chlorophenyl)ethyl]carbamothioylamino]-4-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 100564809 |
| Molecular Formula | C17H19ClN4O2S |
| Molecular Weight | 378.89 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | ethyl 2-[[(1S)-1-(4-chlorophenyl)ethyl]carbamothioylamino]-4-methylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC(=S)N[C@@H](C)c2ccc(Cl)cc2)nc1C |
| InChI | InChI=1S/C17H19ClN4O2S/c1-4-24-15(23)14-9-19-16(20-11(14)3)22-17(25)21-10(2)12-5-7-13(18)8-6-12/h5-10H,4H2,1-3H3,(H2,19,20,21,22,25)/t10-/m0/s1 |
| InChIKey | LIZADOKXZCLUJI-JTQLQIEISA-N |
| XLogP | 3.66 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.89 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|