C14H23N3O3 — CID 83179837
ethyl 2-[(1-methoxy-3-methylbutan-2-yl)amino]-4-methylpyrimidine-5-carboxylate (PubChem CID 83179837) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is ethyl 2-[(1-methoxy-3-methylbutan-2-yl)amino]-4-methylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[(1-methoxy-3-methylbutan-2-yl)amino]-4-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 83179837 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | ethyl 2-[(1-methoxy-3-methylbutan-2-yl)amino]-4-methylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC(COC)C(C)C)nc1C |
| InChI | InChI=1S/C14H23N3O3/c1-6-20-13(18)11-7-15-14(16-10(11)4)17-12(8-19-5)9(2)3/h7,9,12H,6,8H2,1-5H3,(H,15,16,17) |
| InChIKey | NRQCGFQNTZLOLK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |