C13H11N3O2 — CID 67884901
bicyclo[2.2.1]hepta-1,3,5-trien-7-one;pyridin-2-ylurea (PubChem CID 67884901) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is bicyclo[2.2.1]hepta-1,3,5-trien-7-one;pyridin-2-ylurea.
| Compound Name | bicyclo[2.2.1]hepta-1,3,5-trien-7-one;pyridin-2-ylurea |
|---|---|
| PubChem CID | 67884901 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | bicyclo[2.2.1]hepta-1,3,5-trien-7-one;pyridin-2-ylurea |
| SMILES | NC(=O)Nc1ccccn1.O=C1C2=CC=C1C=C2 |
| InChI | InChI=1S/C7H4O.C6H7N3O/c8-7-5-1-2-6(7)4-3-5;7-6(10)9-5-3-1-2-4-8-5/h1-4H;1-4H,(H3,7,8,9,10) |
| InChIKey | GZYBDTQAMHOCIY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |