C15H12IN3O3S — CID 3519140
N-[[(4-hydroxybenzoyl)amino]carbamothioyl]-2-iodobenzamide (PubChem CID 3519140) has the molecular formula C15H12IN3O3S and a molecular weight of 441.25 g/mol. Its IUPAC name is N-[[(4-hydroxybenzoyl)amino]carbamothioyl]-2-iodobenzamide.
| Compound Name | N-[[(4-hydroxybenzoyl)amino]carbamothioyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 3519140 |
| Molecular Formula | C15H12IN3O3S |
| Molecular Weight | 441.25 g/mol |
| Exact Mass | 440.96 |
| IUPAC Name | N-[[(4-hydroxybenzoyl)amino]carbamothioyl]-2-iodobenzamide |
| SMILES | O=C(NNC(=S)NC(=O)c1ccccc1I)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H12IN3O3S/c16-12-4-2-1-3-11(12)14(22)17-15(23)19-18-13(21)9-5-7-10(20)8-6-9/h1-8,20H,(H,18,21)(H2,17,19,22,23) |
| InChIKey | BYWXXUIGQGBIMV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|