C14H11ClN4O2S — CID 3534444
2-chloro-N-[(pyridine-4-carbonylamino)carbamothioyl]benzamide (PubChem CID 3534444) has the molecular formula C14H11ClN4O2S and a molecular weight of 334.79 g/mol. Its IUPAC name is 2-chloro-N-[(pyridine-4-carbonylamino)carbamothioyl]benzamide.
| Compound Name | 2-chloro-N-[(pyridine-4-carbonylamino)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3534444 |
| Molecular Formula | C14H11ClN4O2S |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2-chloro-N-[(pyridine-4-carbonylamino)carbamothioyl]benzamide |
| SMILES | O=C(NNC(=S)NC(=O)c1ccccc1Cl)c1ccncc1 |
| InChI | InChI=1S/C14H11ClN4O2S/c15-11-4-2-1-3-10(11)13(21)17-14(22)19-18-12(20)9-5-7-16-8-6-9/h1-8H,(H,18,20)(H2,17,19,21,22) |
| InChIKey | JAFCLMQTLZPUPZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|