C9H7Cl3N4O2S — CID 3291335
2,2,2-trichloro-N-[(pyridine-4-carbonylamino)carbamothioyl]acetamide (PubChem CID 3291335) has the molecular formula C9H7Cl3N4O2S and a molecular weight of 341.61 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(pyridine-4-carbonylamino)carbamothioyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(pyridine-4-carbonylamino)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3291335 |
| Molecular Formula | C9H7Cl3N4O2S |
| Molecular Weight | 341.61 g/mol |
| Exact Mass | 339.94 |
| IUPAC Name | 2,2,2-trichloro-N-[(pyridine-4-carbonylamino)carbamothioyl]acetamide |
| SMILES | O=C(NNC(=S)NC(=O)C(Cl)(Cl)Cl)c1ccncc1 |
| InChI | InChI=1S/C9H7Cl3N4O2S/c10-9(11,12)7(18)14-8(19)16-15-6(17)5-1-3-13-4-2-5/h1-4H,(H,15,17)(H2,14,16,18,19) |
| InChIKey | RTYVEPKHBBYQHT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.61 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|