C19H24N4OS — CID 134113820
1-[2,6-di(propan-2-yl)phenyl]-3-(pyridine-4-carbonylamino)thiourea (PubChem CID 134113820) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-(pyridine-4-carbonylamino)thiourea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(pyridine-4-carbonylamino)thiourea |
|---|---|
| PubChem CID | 134113820 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(pyridine-4-carbonylamino)thiourea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=S)NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C19H24N4OS/c1-12(2)15-6-5-7-16(13(3)4)17(15)21-19(25)23-22-18(24)14-8-10-20-11-9-14/h5-13H,1-4H3,(H,22,24)(H2,21,23,25) |
| InChIKey | CPEVJEKIOBYXRS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|