C19H25N3S — CID 134116326
1-[2,6-di(propan-2-yl)phenyl]-3-(pyridin-4-ylmethyl)thiourea (PubChem CID 134116326) has the molecular formula C19H25N3S and a molecular weight of 327.50 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-(pyridin-4-ylmethyl)thiourea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(pyridin-4-ylmethyl)thiourea |
|---|---|
| PubChem CID | 134116326 |
| Molecular Formula | C19H25N3S |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(pyridin-4-ylmethyl)thiourea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=S)NCc1ccncc1 |
| InChI | InChI=1S/C19H25N3S/c1-13(2)16-6-5-7-17(14(3)4)18(16)22-19(23)21-12-15-8-10-20-11-9-15/h5-11,13-14H,12H2,1-4H3,(H2,21,22,23) |
| InChIKey | ZMSLAMVAYWXIFF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|