C23H31N3O2 — CID 108963768
N-[2,6-di(propan-2-yl)phenyl]-2,2-dimethyl-N'-(pyridin-4-ylmethyl)propanediamide (PubChem CID 108963768) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2,2-dimethyl-N'-(pyridin-4-ylmethyl)propanediamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2,2-dimethyl-N'-(pyridin-4-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 108963768 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2,2-dimethyl-N'-(pyridin-4-ylmethyl)propanediamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)C(C)(C)C(=O)NCc1ccncc1 |
| InChI | InChI=1S/C23H31N3O2/c1-15(2)18-8-7-9-19(16(3)4)20(18)26-22(28)23(5,6)21(27)25-14-17-10-12-24-13-11-17/h7-13,15-16H,14H2,1-6H3,(H,25,27)(H,26,28) |
| InChIKey | YVLSUPOMLQBTMK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|