C21H34N2O2 — CID 108958316
N-butan-2-yl-N'-[2,6-di(propan-2-yl)phenyl]-2,2-dimethylpropanediamide (PubChem CID 108958316) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is N-butan-2-yl-N'-[2,6-di(propan-2-yl)phenyl]-2,2-dimethylpropanediamide.
| Compound Name | N-butan-2-yl-N'-[2,6-di(propan-2-yl)phenyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108958316 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | N-butan-2-yl-N'-[2,6-di(propan-2-yl)phenyl]-2,2-dimethylpropanediamide |
| SMILES | CCC(C)NC(=O)C(C)(C)C(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C21H34N2O2/c1-9-15(6)22-19(24)21(7,8)20(25)23-18-16(13(2)3)11-10-12-17(18)14(4)5/h10-15H,9H2,1-8H3,(H,22,24)(H,23,25) |
| InChIKey | ANZCSBXTAGEGKS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|